C24H17N3O4 — CID 19259078
1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(9-oxofluoren-2-yl)urea (PubChem CID 19259078) has the molecular formula C24H17N3O4 and a molecular weight of 411.42 g/mol. Its IUPAC name is 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(9-oxofluoren-2-yl)urea.
| Compound Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(9-oxofluoren-2-yl)urea |
|---|---|
| PubChem CID | 19259078 |
| Molecular Formula | C24H17N3O4 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(9-oxofluoren-2-yl)urea |
| SMILES | O=C(NCCN1C(=O)c2ccccc2C1=O)Nc1ccc2c(c1)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C24H17N3O4/c28-21-17-6-2-1-5-15(17)16-10-9-14(13-20(16)21)26-24(31)25-11-12-27-22(29)18-7-3-4-8-19(18)23(27)30/h1-10,13H,11-12H2,(H2,25,26,31) |
| InChIKey | DNJBMDMUOKJORC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|