C25H23N3O3 — CID 108889375
1-benzhydryl-3-[3-(1,3-dioxoisoindol-2-yl)propyl]urea (PubChem CID 108889375) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is 1-benzhydryl-3-[3-(1,3-dioxoisoindol-2-yl)propyl]urea.
| Compound Name | 1-benzhydryl-3-[3-(1,3-dioxoisoindol-2-yl)propyl]urea |
|---|---|
| PubChem CID | 108889375 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 1-benzhydryl-3-[3-(1,3-dioxoisoindol-2-yl)propyl]urea |
| SMILES | O=C(NCCCN1C(=O)c2ccccc2C1=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H23N3O3/c29-23-20-14-7-8-15-21(20)24(30)28(23)17-9-16-26-25(31)27-22(18-10-3-1-4-11-18)19-12-5-2-6-13-19/h1-8,10-15,22H,9,16-17H2,(H2,26,27,31) |
| InChIKey | ILJWCYLNQPNHBE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|