C18H23N3O5 — CID 108889388
6-[3-(1,3-dioxoisoindol-2-yl)propylcarbamoylamino]hexanoic acid (PubChem CID 108889388) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is 6-[3-(1,3-dioxoisoindol-2-yl)propylcarbamoylamino]hexanoic acid.
| Compound Name | 6-[3-(1,3-dioxoisoindol-2-yl)propylcarbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 108889388 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 6-[3-(1,3-dioxoisoindol-2-yl)propylcarbamoylamino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)NCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H23N3O5/c22-15(23)9-2-1-5-10-19-18(26)20-11-6-12-21-16(24)13-7-3-4-8-14(13)17(21)25/h3-4,7-8H,1-2,5-6,9-12H2,(H,22,23)(H2,19,20,26) |
| InChIKey | ICXKBWRMIPSZJM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|