C32H42N4O4 — CID 46192998
2-[3-[10-[3-(1,3-dioxoisoindol-2-yl)propylamino]decylamino]propyl]isoindole-1,3-dione (PubChem CID 46192998) has the molecular formula C32H42N4O4 and a molecular weight of 546.71 g/mol. Its IUPAC name is 2-[3-[10-[3-(1,3-dioxoisoindol-2-yl)propylamino]decylamino]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[10-[3-(1,3-dioxoisoindol-2-yl)propylamino]decylamino]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 46192998 |
| Molecular Formula | C32H42N4O4 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | 2-[3-[10-[3-(1,3-dioxoisoindol-2-yl)propylamino]decylamino]propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCNCCCCCCCCCCNCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C32H42N4O4/c37-29-25-15-7-8-16-26(25)30(38)35(29)23-13-21-33-19-11-5-3-1-2-4-6-12-20-34-22-14-24-36-31(39)27-17-9-10-18-28(27)32(36)40/h7-10,15-18,33-34H,1-6,11-14,19-24H2 |
| InChIKey | UHQQAFHOVKQVSK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|