C16H22N2O5S2 — CID 568343
1,3-dioxo-2-[5-(3-sulfosulfanylpropylamino)pentyl]isoindole (PubChem CID 568343) has the molecular formula C16H22N2O5S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 1,3-dioxo-2-[5-(3-sulfosulfanylpropylamino)pentyl]isoindole.
| Compound Name | 1,3-dioxo-2-[5-(3-sulfosulfanylpropylamino)pentyl]isoindole |
|---|---|
| PubChem CID | 568343 |
| Molecular Formula | C16H22N2O5S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 1,3-dioxo-2-[5-(3-sulfosulfanylpropylamino)pentyl]isoindole |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCCNCCCSS(=O)(=O)O |
| InChI | InChI=1S/C16H22N2O5S2/c19-15-13-7-2-3-8-14(13)16(20)18(15)11-5-1-4-9-17-10-6-12-24-25(21,22)23/h2-3,7-8,17H,1,4-6,9-12H2,(H,21,22,23) |
| InChIKey | QVFJIUKVNYIGEJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|