C22H30N4O2 — CID 25198956
2-[3-[4-(3-aminopropylamino)butylamino]propyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 25198956) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 2-[3-[4-(3-aminopropylamino)butylamino]propyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[3-[4-(3-aminopropylamino)butylamino]propyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 25198956 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 2-[3-[4-(3-aminopropylamino)butylamino]propyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | NCCCNCCCCNCCCN1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C22H30N4O2/c23-11-5-14-24-12-1-2-13-25-15-6-16-26-21(27)18-9-3-7-17-8-4-10-19(20(17)18)22(26)28/h3-4,7-10,24-25H,1-2,5-6,11-16,23H2 |
| InChIKey | VXZFCABGUMWSHC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|