C19H23N3O2 — CID 171358194
2-[3-[2-(dimethylamino)ethylamino]propyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 171358194) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-[3-[2-(dimethylamino)ethylamino]propyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[3-[2-(dimethylamino)ethylamino]propyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 171358194 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 2-[3-[2-(dimethylamino)ethylamino]propyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | CN(C)CCNCCCN1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C19H23N3O2/c1-21(2)13-11-20-10-5-12-22-18(23)15-8-3-6-14-7-4-9-16(17(14)15)19(22)24/h3-4,6-9,20H,5,10-13H2,1-2H3 |
| InChIKey | ZGTWMXCSQCAOQI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|