C33H32N4O4 — CID 71175485
2-[2-[3-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl-methylamino]butylamino]ethyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 71175485) has the molecular formula C33H32N4O4 and a molecular weight of 548.64 g/mol. Its IUPAC name is 2-[2-[3-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl-methylamino]butylamino]ethyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[2-[3-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl-methylamino]butylamino]ethyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 71175485 |
| Molecular Formula | C33H32N4O4 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | 2-[2-[3-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl-methylamino]butylamino]ethyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | CC(CCNCCN1C(=O)c2cccc3cccc(c23)C1=O)N(C)CCN1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C33H32N4O4/c1-21(35(2)19-20-37-32(40)26-13-5-9-23-10-6-14-27(29(23)26)33(37)41)15-16-34-17-18-36-30(38)24-11-3-7-22-8-4-12-25(28(22)24)31(36)39/h3-14,21,34H,15-20H2,1-2H3 |
| InChIKey | OPYSGAWBQYSAKN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|