C37H40N4O4 — CID 143238228
2-[2-[[2-[[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl-methylamino]methyl]-2-methylhexyl]amino]ethyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 143238228) has the molecular formula C37H40N4O4 and a molecular weight of 604.75 g/mol. Its IUPAC name is 2-[2-[[2-[[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl-methylamino]methyl]-2-methylhexyl]amino]ethyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[2-[[2-[[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl-methylamino]methyl]-2-methylhexyl]amino]ethyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 143238228 |
| Molecular Formula | C37H40N4O4 |
| Molecular Weight | 604.75 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | 2-[2-[[2-[[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl-methylamino]methyl]-2-methylhexyl]amino]ethyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | CCCCC(C)(CNCCN1C(=O)c2cccc3cccc(c23)C1=O)CN(C)CCN1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C37H40N4O4/c1-4-5-18-37(2,23-38-19-20-40-33(42)27-14-6-10-25-11-7-15-28(31(25)27)34(40)43)24-39(3)21-22-41-35(44)29-16-8-12-26-13-9-17-30(32(26)29)36(41)45/h6-17,38H,4-5,18-24H2,1-3H3 |
| InChIKey | NAGHZNRIBCVLJE-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.75 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|