C21H28N4O2 — CID 68583900
2-[2-[3-[2-aminoethyl(methyl)amino]propyl-methylamino]ethyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 68583900) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 2-[2-[3-[2-aminoethyl(methyl)amino]propyl-methylamino]ethyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[2-[3-[2-aminoethyl(methyl)amino]propyl-methylamino]ethyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 68583900 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 2-[2-[3-[2-aminoethyl(methyl)amino]propyl-methylamino]ethyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | CN(CCN)CCCN(C)CCN1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C21H28N4O2/c1-23(13-10-22)11-5-12-24(2)14-15-25-20(26)17-8-3-6-16-7-4-9-18(19(16)17)21(25)27/h3-4,6-9H,5,10-15,22H2,1-2H3 |
| InChIKey | XGYZBMVWUFQBOS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|