C33H31N3O4S — CID 71192157
2-[2-[3-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl-methylamino]propylsulfanyl]ethyl]-6-methylbenzo[de]isoquinoline-1,3-dione (PubChem CID 71192157) has the molecular formula C33H31N3O4S and a molecular weight of 565.70 g/mol. Its IUPAC name is 2-[2-[3-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl-methylamino]propylsulfanyl]ethyl]-6-methylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[2-[3-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl-methylamino]propylsulfanyl]ethyl]-6-methylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 71192157 |
| Molecular Formula | C33H31N3O4S |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | 2-[2-[3-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl-methylamino]propylsulfanyl]ethyl]-6-methylbenzo[de]isoquinoline-1,3-dione |
| SMILES | Cc1ccc2c3c(cccc13)C(=O)N(CCSCCCN(C)CCN1C(=O)c3cccc4cccc(c34)C1=O)C2=O |
| InChI | InChI=1S/C33H31N3O4S/c1-21-13-14-27-29-23(21)9-5-12-26(29)32(39)36(33(27)40)18-20-41-19-6-15-34(2)16-17-35-30(37)24-10-3-7-22-8-4-11-25(28(22)24)31(35)38/h3-5,7-14H,6,15-20H2,1-2H3 |
| InChIKey | QGXZSXQSPNHITE-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|