C38H45N3O5 — CID 143501203
2-[2-[3-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethoxy]propyl-methylamino]ethyl]-4-methylbenzo[de]isoquinoline-1,3-dione;ethane;propane (PubChem CID 143501203) has the molecular formula C38H45N3O5 and a molecular weight of 623.79 g/mol. Its IUPAC name is 2-[2-[3-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethoxy]propyl-methylamino]ethyl]-4-methylbenzo[de]isoquinoline-1,3-dione;ethane;propane.
| Compound Name | 2-[2-[3-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethoxy]propyl-methylamino]ethyl]-4-methylbenzo[de]isoquinoline-1,3-dione;ethane;propane |
|---|---|
| PubChem CID | 143501203 |
| Molecular Formula | C38H45N3O5 |
| Molecular Weight | 623.79 g/mol |
| Exact Mass | 623.34 |
| IUPAC Name | 2-[2-[3-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethoxy]propyl-methylamino]ethyl]-4-methylbenzo[de]isoquinoline-1,3-dione;ethane;propane |
| SMILES | CC.CCC.Cc1ccc2cccc3c2c1C(=O)N(CCN(C)CCCOCCN1C(=O)c2cccc4cccc(c24)C1=O)C3=O |
| InChI | InChI=1S/C33H31N3O5.C3H8.C2H6/c1-21-13-14-23-9-5-12-26-29(23)27(21)33(40)35(32(26)39)17-16-34(2)15-6-19-41-20-18-36-30(37)24-10-3-7-22-8-4-11-25(28(22)24)31(36)38;1-3-2;1-2/h3-5,7-14H,6,15-20H2,1-2H3;3H2,1-2H3;1-2H3 |
| InChIKey | CLAQWAYMIIHJMS-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.79 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|