C36H38N4O4 — CID 143501063
2-[2-[methyl-[6-[2-[(4E)-5-methyl-1,3-dioxo-4-prop-2-ynylideneisoquinolin-2-yl]ethylamino]hexyl]amino]ethyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 143501063) has the molecular formula C36H38N4O4 and a molecular weight of 590.72 g/mol. Its IUPAC name is 2-[2-[methyl-[6-[2-[(4E)-5-methyl-1,3-dioxo-4-prop-2-ynylideneisoquinolin-2-yl]ethylamino]hexyl]amino]ethyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[2-[methyl-[6-[2-[(4E)-5-methyl-1,3-dioxo-4-prop-2-ynylideneisoquinolin-2-yl]ethylamino]hexyl]amino]ethyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 143501063 |
| Molecular Formula | C36H38N4O4 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.29 |
| IUPAC Name | 2-[2-[methyl-[6-[2-[(4E)-5-methyl-1,3-dioxo-4-prop-2-ynylideneisoquinolin-2-yl]ethylamino]hexyl]amino]ethyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | C#C/C=C1/C(=O)N(CCNCCCCCCN(C)CCN2C(=O)c3cccc4cccc(c34)C2=O)C(=O)c2cccc(C)c21 |
| InChI | InChI=1S/C36H38N4O4/c1-4-12-27-31-25(2)13-9-16-28(31)34(42)39(33(27)41)22-20-37-19-7-5-6-8-21-38(3)23-24-40-35(43)29-17-10-14-26-15-11-18-30(32(26)29)36(40)44/h1,9-18,37H,5-8,19-24H2,2-3H3/b27-12+ |
| InChIKey | BJUZQGGFWVVOPZ-KKMKTNMSSA-N |
| XLogP | 4.53 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|