C19H25Cl2N3O2 — CID 171357834
2-[5-(2-aminoethylamino)pentyl]benzo[de]isoquinoline-1,3-dione;dihydrochloride (PubChem CID 171357834) has the molecular formula C19H25Cl2N3O2 and a molecular weight of 398.33 g/mol. Its IUPAC name is 2-[5-(2-aminoethylamino)pentyl]benzo[de]isoquinoline-1,3-dione;dihydrochloride.
| Compound Name | 2-[5-(2-aminoethylamino)pentyl]benzo[de]isoquinoline-1,3-dione;dihydrochloride |
|---|---|
| PubChem CID | 171357834 |
| Molecular Formula | C19H25Cl2N3O2 |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 2-[5-(2-aminoethylamino)pentyl]benzo[de]isoquinoline-1,3-dione;dihydrochloride |
| SMILES | Cl.Cl.NCCNCCCCCN1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C19H23N3O2.2ClH/c20-10-12-21-11-2-1-3-13-22-18(23)15-8-4-6-14-7-5-9-16(17(14)15)19(22)24;;/h4-9,21H,1-3,10-13,20H2;2*1H |
| InChIKey | CXKIKOKSPIFQRJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|