C30H42N6O4 — CID 57386831
6,13-bis[4-(4-aminobutylamino)butyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 57386831) has the molecular formula C30H42N6O4 and a molecular weight of 550.70 g/mol. Its IUPAC name is 6,13-bis[4-(4-aminobutylamino)butyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6,13-bis[4-(4-aminobutylamino)butyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 57386831 |
| Molecular Formula | C30H42N6O4 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.33 |
| IUPAC Name | 6,13-bis[4-(4-aminobutylamino)butyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | NCCCCNCCCCN1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)N(CCCCNCCCCN)C3=O |
| InChI | InChI=1S/C30H42N6O4/c31-13-1-3-15-33-17-5-7-19-35-27(37)21-9-11-23-26-24(12-10-22(25(21)26)28(35)38)30(40)36(29(23)39)20-8-6-18-34-16-4-2-14-32/h9-12,33-34H,1-8,13-20,31-32H2 |
| InChIKey | DAHVGHOMNLKYRL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 150.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|