C29H42N6O3 — CID 23521214
N-[3-[6-[2-[6-(2-aminoethylamino)hexylamino]ethylamino]-1,3-dioxobenzo[de]isoquinolin-2-yl]propyl]-2-methylprop-2-enamide (PubChem CID 23521214) has the molecular formula C29H42N6O3 and a molecular weight of 522.69 g/mol. Its IUPAC name is N-[3-[6-[2-[6-(2-aminoethylamino)hexylamino]ethylamino]-1,3-dioxobenzo[de]isoquinolin-2-yl]propyl]-2-methylprop-2-enamide.
| Compound Name | N-[3-[6-[2-[6-(2-aminoethylamino)hexylamino]ethylamino]-1,3-dioxobenzo[de]isoquinolin-2-yl]propyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 23521214 |
| Molecular Formula | C29H42N6O3 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.33 |
| IUPAC Name | N-[3-[6-[2-[6-(2-aminoethylamino)hexylamino]ethylamino]-1,3-dioxobenzo[de]isoquinolin-2-yl]propyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCN1C(=O)c2cccc3c(NCCNCCCCCCNCCN)ccc(c23)C1=O |
| InChI | InChI=1S/C29H42N6O3/c1-21(2)27(36)34-16-8-20-35-28(37)23-10-7-9-22-25(12-11-24(26(22)23)29(35)38)33-19-18-32-15-6-4-3-5-14-31-17-13-30/h7,9-12,31-33H,1,3-6,8,13-20,30H2,2H3,(H,34,36) |
| InChIKey | UMCIQMTWSHRHFX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|