C30H42N2O4 — CID 171854398
10-[6-(octylamino)-1,3-dioxobenzo[de]isoquinolin-2-yl]decanoic acid (PubChem CID 171854398) has the molecular formula C30H42N2O4 and a molecular weight of 494.68 g/mol. Its IUPAC name is 10-[6-(octylamino)-1,3-dioxobenzo[de]isoquinolin-2-yl]decanoic acid.
| Compound Name | 10-[6-(octylamino)-1,3-dioxobenzo[de]isoquinolin-2-yl]decanoic acid |
|---|---|
| PubChem CID | 171854398 |
| Molecular Formula | C30H42N2O4 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | 10-[6-(octylamino)-1,3-dioxobenzo[de]isoquinolin-2-yl]decanoic acid |
| SMILES | CCCCCCCCNc1ccc2c3c(cccc13)C(=O)N(CCCCCCCCCC(=O)O)C2=O |
| InChI | InChI=1S/C30H42N2O4/c1-2-3-4-5-10-13-21-31-26-20-19-25-28-23(26)16-15-17-24(28)29(35)32(30(25)36)22-14-11-8-6-7-9-12-18-27(33)34/h15-17,19-20,31H,2-14,18,21-22H2,1H3,(H,33,34) |
| InChIKey | IPODCJRIFHCPBK-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|