C22H28N2O3 — CID 44787344
6-(2-hydroxyethylamino)-2-octylbenzo[de]isoquinoline-1,3-dione (PubChem CID 44787344) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 6-(2-hydroxyethylamino)-2-octylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-(2-hydroxyethylamino)-2-octylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 44787344 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 6-(2-hydroxyethylamino)-2-octylbenzo[de]isoquinoline-1,3-dione |
| SMILES | CCCCCCCCN1C(=O)c2cccc3c(NCCO)ccc(c23)C1=O |
| InChI | InChI=1S/C22H28N2O3/c1-2-3-4-5-6-7-14-24-21(26)17-10-8-9-16-19(23-13-15-25)12-11-18(20(16)17)22(24)27/h8-12,23,25H,2-7,13-15H2,1H3 |
| InChIKey | SPELINQWAMNWGP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|