C40H48N4O4 — CID 142370915
2-[3-(2,2-dimethylpropylamino)propyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 142370915) has the molecular formula C40H48N4O4 and a molecular weight of 648.85 g/mol. Its IUPAC name is 2-[3-(2,2-dimethylpropylamino)propyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[3-(2,2-dimethylpropylamino)propyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 142370915 |
| Molecular Formula | C40H48N4O4 |
| Molecular Weight | 648.85 g/mol |
| Exact Mass | 648.37 |
| IUPAC Name | 2-[3-(2,2-dimethylpropylamino)propyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | CC(C)(C)CNCCCN1C(=O)c2cccc3cccc(c23)C1=O.CC(C)(C)CNCCCN1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/2C20H24N2O2/c2*1-20(2,3)13-21-11-6-12-22-18(23)15-9-4-7-14-8-5-10-16(17(14)15)19(22)24/h2*4-5,7-10,21H,6,11-13H2,1-3H3 |
| InChIKey | IXDDCXPXPHIULX-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.85 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|