C37H42N4O4+2 — CID 46888340
3-(1,3-dioxobenzo[de]isoquinolin-2-yl)propyl-[3-[3-(1,3-dioxobenzo[de]isoquinolin-2-yl)propyl-dimethylazaniumyl]propyl]-dimethylazanium (PubChem CID 46888340) has the molecular formula C37H42N4O4+2 and a molecular weight of 606.77 g/mol. Its IUPAC name is 3-(1,3-dioxobenzo[de]isoquinolin-2-yl)propyl-[3-[3-(1,3-dioxobenzo[de]isoquinolin-2-yl)propyl-dimethylazaniumyl]propyl]-dimethylazanium.
| Compound Name | 3-(1,3-dioxobenzo[de]isoquinolin-2-yl)propyl-[3-[3-(1,3-dioxobenzo[de]isoquinolin-2-yl)propyl-dimethylazaniumyl]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 46888340 |
| Molecular Formula | C37H42N4O4+2 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.32 |
| IUPAC Name | 3-(1,3-dioxobenzo[de]isoquinolin-2-yl)propyl-[3-[3-(1,3-dioxobenzo[de]isoquinolin-2-yl)propyl-dimethylazaniumyl]propyl]-dimethylazanium |
| SMILES | C[N+](C)(CCCN1C(=O)c2cccc3cccc(c23)C1=O)CCC[N+](C)(C)CCCN1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C37H42N4O4/c1-40(2,22-9-20-38-34(42)28-16-5-12-26-13-6-17-29(32(26)28)35(38)43)24-11-25-41(3,4)23-10-21-39-36(44)30-18-7-14-27-15-8-19-31(33(27)30)37(39)45/h5-8,12-19H,9-11,20-25H2,1-4H3/q+2 |
| InChIKey | CWCLKFGIPSIBGF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|