C14H19N2O2+ — CID 19927294
3-(1,3-dioxoisoindol-2-yl)propyl-trimethylazanium (PubChem CID 19927294) has the molecular formula C14H19N2O2+ and a molecular weight of 247.32 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl-trimethylazanium.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl-trimethylazanium |
|---|---|
| PubChem CID | 19927294 |
| Molecular Formula | C14H19N2O2+ |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H19N2O2/c1-16(2,3)10-6-9-15-13(17)11-7-4-5-8-12(11)14(15)18/h4-5,7-8H,6,9-10H2,1-3H3/q+1 |
| InChIKey | ITUYZKDPJCZALT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|