C11H10NO3- — CID 140721734
3-(1,3-dioxoisoindol-2-yl)propan-1-olate (PubChem CID 140721734) has the molecular formula C11H10NO3- and a molecular weight of 204.21 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propan-1-olate.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propan-1-olate |
|---|---|
| PubChem CID | 140721734 |
| Molecular Formula | C11H10NO3- |
| Molecular Weight | 204.21 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propan-1-olate |
| SMILES | O=C1c2ccccc2C(=O)N1CCC[O-] |
| InChI | InChI=1S/C11H10NO3/c13-7-3-6-12-10(14)8-4-1-2-5-9(8)11(12)15/h1-2,4-5H,3,6-7H2/q-1 |
| InChIKey | UTLBQLPUFHMHPH-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.21 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|