C23H24N2O6 — CID 21468228
2-(4-hydroxybutyl)isoindole-1,3-dione;2-(3-hydroxypropyl)isoindole-1,3-dione (PubChem CID 21468228) has the molecular formula C23H24N2O6 and a molecular weight of 424.45 g/mol. Its IUPAC name is 2-(4-hydroxybutyl)isoindole-1,3-dione;2-(3-hydroxypropyl)isoindole-1,3-dione.
| Compound Name | 2-(4-hydroxybutyl)isoindole-1,3-dione;2-(3-hydroxypropyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 21468228 |
| Molecular Formula | C23H24N2O6 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 2-(4-hydroxybutyl)isoindole-1,3-dione;2-(3-hydroxypropyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCO.O=C1c2ccccc2C(=O)N1CCCO |
| InChI | InChI=1S/C12H13NO3.C11H11NO3/c14-8-4-3-7-13-11(15)9-5-1-2-6-10(9)12(13)16;13-7-3-6-12-10(14)8-4-1-2-5-9(8)11(12)15/h1-2,5-6,14H,3-4,7-8H2;1-2,4-5,13H,3,6-7H2 |
| InChIKey | TYXYYUMEQVRLBN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|