C16H15NO6 — CID 139145891
benzene-1,3,5-triol;2-(2-hydroxyethyl)isoindole-1,3-dione (PubChem CID 139145891) has the molecular formula C16H15NO6 and a molecular weight of 317.30 g/mol. Its IUPAC name is benzene-1,3,5-triol;2-(2-hydroxyethyl)isoindole-1,3-dione.
| Compound Name | benzene-1,3,5-triol;2-(2-hydroxyethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 139145891 |
| Molecular Formula | C16H15NO6 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | benzene-1,3,5-triol;2-(2-hydroxyethyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCO.Oc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C10H9NO3.C6H6O3/c12-6-5-11-9(13)7-3-1-2-4-8(7)10(11)14;7-4-1-5(8)3-6(9)2-4/h1-4,12H,5-6H2;1-3,7-9H |
| InChIKey | PIVUMFWVSPTOEW-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|