C11H12NO2+ — CID 174827386
hydron;2-propylisoindole-1,3-dione (PubChem CID 174827386) has the molecular formula C11H12NO2+ and a molecular weight of 190.22 g/mol. Its IUPAC name is hydron;2-propylisoindole-1,3-dione.
| Compound Name | hydron;2-propylisoindole-1,3-dione |
|---|---|
| PubChem CID | 174827386 |
| Molecular Formula | C11H12NO2+ |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | hydron;2-propylisoindole-1,3-dione |
| SMILES | CCCN1C(=O)c2ccccc2C1=O.[H+] |
| InChI | InChI=1S/C11H11NO2/c1-2-7-12-10(13)8-5-3-4-6-9(8)11(12)14/h3-6H,2,7H2,1H3/p+1 |
| InChIKey | RLARUBPTQYKZKA-UHFFFAOYSA-O |
| XLogP | 1.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|