C18H25NO2S — CID 139959295
2-(7-propylsulfanylheptyl)isoindole-1,3-dione (PubChem CID 139959295) has the molecular formula C18H25NO2S and a molecular weight of 319.47 g/mol. Its IUPAC name is 2-(7-propylsulfanylheptyl)isoindole-1,3-dione.
| Compound Name | 2-(7-propylsulfanylheptyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 139959295 |
| Molecular Formula | C18H25NO2S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 2-(7-propylsulfanylheptyl)isoindole-1,3-dione |
| SMILES | CCCSCCCCCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H25NO2S/c1-2-13-22-14-9-5-3-4-8-12-19-17(20)15-10-6-7-11-16(15)18(19)21/h6-7,10-11H,2-5,8-9,12-14H2,1H3 |
| InChIKey | PHLCJOGMVJTDSF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|