C28H32N2O4S2 — CID 15499684
2-[6-[6-(1,3-dioxoisoindol-2-yl)hexyldisulfanyl]hexyl]isoindole-1,3-dione (PubChem CID 15499684) has the molecular formula C28H32N2O4S2 and a molecular weight of 524.71 g/mol. Its IUPAC name is 2-[6-[6-(1,3-dioxoisoindol-2-yl)hexyldisulfanyl]hexyl]isoindole-1,3-dione.
| Compound Name | 2-[6-[6-(1,3-dioxoisoindol-2-yl)hexyldisulfanyl]hexyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 15499684 |
| Molecular Formula | C28H32N2O4S2 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 2-[6-[6-(1,3-dioxoisoindol-2-yl)hexyldisulfanyl]hexyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCCCSSCCCCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H32N2O4S2/c31-25-21-13-5-6-14-22(21)26(32)29(25)17-9-1-3-11-19-35-36-20-12-4-2-10-18-30-27(33)23-15-7-8-16-24(23)28(30)34/h5-8,13-16H,1-4,9-12,17-20H2 |
| InChIKey | VYKMSQBHOUTCSF-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|