C48H48N5O8+ — CID 10056713
tetrakis[4-(1,3-dioxoisoindol-2-yl)butyl]azanium (PubChem CID 10056713) has the molecular formula C48H48N5O8+ and a molecular weight of 822.94 g/mol. Its IUPAC name is tetrakis[4-(1,3-dioxoisoindol-2-yl)butyl]azanium.
| Compound Name | tetrakis[4-(1,3-dioxoisoindol-2-yl)butyl]azanium |
|---|---|
| PubChem CID | 10056713 |
| Molecular Formula | C48H48N5O8+ |
| Molecular Weight | 822.94 g/mol |
| Exact Mass | 822.35 |
| IUPAC Name | tetrakis[4-(1,3-dioxoisoindol-2-yl)butyl]azanium |
| SMILES | O=C1c2ccccc2C(=O)N1CCCC[N+](CCCCN1C(=O)c2ccccc2C1=O)(CCCCN1C(=O)c2ccccc2C1=O)CCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C48H48N5O8/c54-41-33-17-1-2-18-34(33)42(55)49(41)25-9-13-29-53(30-14-10-26-50-43(56)35-19-3-4-20-36(35)44(50)57,31-15-11-27-51-45(58)37-21-5-6-22-38(37)46(51)59)32-16-12-28-52-47(60)39-23-7-8-24-40(39)48(52)61/h1-8,17-24H,9-16,25-32H2/q+1 |
| InChIKey | IURACEPPHUHCIB-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 149.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.94 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|