C25H43Br2N3O2 — CID 10099667
3-(1,3-dioxoisoindol-2-yl)propyl-dimethyl-[6-(triethylazaniumyl)hexyl]azanium dibromide (PubChem CID 10099667) has the molecular formula C25H43Br2N3O2 and a molecular weight of 577.45 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl-dimethyl-[6-(triethylazaniumyl)hexyl]azanium dibromide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl-dimethyl-[6-(triethylazaniumyl)hexyl]azanium dibromide |
|---|---|
| PubChem CID | 10099667 |
| Molecular Formula | C25H43Br2N3O2 |
| Molecular Weight | 577.45 g/mol |
| Exact Mass | 575.17 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl-dimethyl-[6-(triethylazaniumyl)hexyl]azanium dibromide |
| SMILES | CC[N+](CC)(CC)CCCCCC[N+](C)(C)CCCN1C(=O)c2ccccc2C1=O.[Br-].[Br-] |
| InChI | InChI=1S/C25H43N3O2.2BrH/c1-6-28(7-2,8-3)21-14-10-9-13-19-27(4,5)20-15-18-26-24(29)22-16-11-12-17-23(22)25(26)30;;/h11-12,16-17H,6-10,13-15,18-21H2,1-5H3;2*1H/q+2;;/p-2 |
| InChIKey | SJMRBEHTWWXZHL-UHFFFAOYSA-L |
| XLogP | -1.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.45 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|