C21H33BrN2O2 — CID 45048265
decyl-[(1,3-dioxoisoindol-2-yl)methyl]-dimethylazanium bromide (PubChem CID 45048265) has the molecular formula C21H33BrN2O2 and a molecular weight of 425.41 g/mol. Its IUPAC name is decyl-[(1,3-dioxoisoindol-2-yl)methyl]-dimethylazanium bromide.
| Compound Name | decyl-[(1,3-dioxoisoindol-2-yl)methyl]-dimethylazanium bromide |
|---|---|
| PubChem CID | 45048265 |
| Molecular Formula | C21H33BrN2O2 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | decyl-[(1,3-dioxoisoindol-2-yl)methyl]-dimethylazanium bromide |
| SMILES | CCCCCCCCCC[N+](C)(C)CN1C(=O)c2ccccc2C1=O.[Br-] |
| InChI | InChI=1S/C21H33N2O2.BrH/c1-4-5-6-7-8-9-10-13-16-23(2,3)17-22-20(24)18-14-11-12-15-19(18)21(22)25;/h11-12,14-15H,4-10,13,16-17H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | XQANVKUPKHVLNY-UHFFFAOYSA-M |
| XLogP | 1.46 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|