C15H22BrN2O2+ — CID 126959212
(1,3-dioxoisoindol-2-yl)methyl-triethylazanium;hydrobromide (PubChem CID 126959212) has the molecular formula C15H22BrN2O2+ and a molecular weight of 342.26 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl-triethylazanium;hydrobromide.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl-triethylazanium;hydrobromide |
|---|---|
| PubChem CID | 126959212 |
| Molecular Formula | C15H22BrN2O2+ |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl-triethylazanium;hydrobromide |
| SMILES | Br.CC[N+](CC)(CC)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H21N2O2.BrH/c1-4-17(5-2,6-3)11-16-14(18)12-9-7-8-10-13(12)15(16)19;/h7-10H,4-6,11H2,1-3H3;1H/q+1; |
| InChIKey | ZLOUQEXHFBNJNH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|