C11H13NO3 — CID 143899638
2-hydroxyisoindole-1,3-dione;propane (PubChem CID 143899638) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-hydroxyisoindole-1,3-dione;propane.
| Compound Name | 2-hydroxyisoindole-1,3-dione;propane |
|---|---|
| PubChem CID | 143899638 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2-hydroxyisoindole-1,3-dione;propane |
| SMILES | CCC.O=C1c2ccccc2C(=O)N1O |
| InChI | InChI=1S/C8H5NO3.C3H8/c10-7-5-3-1-2-4-6(5)8(11)9(7)12;1-3-2/h1-4,12H;3H2,1-2H3 |
| InChIKey | WTDVPRTYCGTZOC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|