About 2-hydroxyisoindole-1,3-dione
2-hydroxyisoindole-1,3-dione (PubChem CID 66775726) has the molecular formula C16H10N2O6
and a molecular weight of 326.26 g/mol. Its IUPAC name is 2-hydroxyisoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-hydroxyisoindole-1,3-dione |
| PubChem CID | 66775726 |
| Molecular Formula | C16H10N2O6 |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 2-hydroxyisoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1O.O=C1c2ccccc2C(=O)N1O |
| InChI | InChI=1S/2C8H5NO3/c2*10-7-5-3-1-2-4-6(5)8(11)9(7)12/h2*1-4,12H |
| InChIKey | YUEFRBKOGCMEAS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyisoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyisoindole-1,3-dione?
The IUPAC name of 2-hydroxyisoindole-1,3-dione (CID 66775726) is 2-hydroxyisoindole-1,3-dione.
What is the SMILES notation for 2-hydroxyisoindole-1,3-dione?
The canonical SMILES for 2-hydroxyisoindole-1,3-dione is O=C1c2ccccc2C(=O)N1O.O=C1c2ccccc2C(=O)N1O.
What is the InChIKey of 2-hydroxyisoindole-1,3-dione?
The InChIKey is YUEFRBKOGCMEAS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H5NO3/c2*10-7-5-3-1-2-4-6(5)8(11)9(7)12/h2*1-4,12H.
What are the key properties of 2-hydroxyisoindole-1,3-dione?
2-hydroxyisoindole-1,3-dione has a molecular weight of 326.26 g/mol, XLogP of 1.34, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyisoindole-1,3-dione is sourced from PubChem (CID 66775726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).