C22H18N2O4 — CID 2911337
2-[2-(1,3-dioxoisoindol-2-yl)cyclohexyl]isoindole-1,3-dione (PubChem CID 2911337) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is 2-[2-(1,3-dioxoisoindol-2-yl)cyclohexyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(1,3-dioxoisoindol-2-yl)cyclohexyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 2911337 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 2-[2-(1,3-dioxoisoindol-2-yl)cyclohexyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C1CCCCC1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H18N2O4/c25-19-13-7-1-2-8-14(13)20(26)23(19)17-11-5-6-12-18(17)24-21(27)15-9-3-4-10-16(15)22(24)28/h1-4,7-10,17-18H,5-6,11-12H2 |
| InChIKey | UWFSWSSYDYLUBT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|