C13H12N2O3 — CID 1494048
2-[(3R)-2-oxopiperidin-3-yl]isoindole-1,3-dione (PubChem CID 1494048) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 2-[(3R)-2-oxopiperidin-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(3R)-2-oxopiperidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 1494048 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2-[(3R)-2-oxopiperidin-3-yl]isoindole-1,3-dione |
| SMILES | O=C1NCCC[C@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H12N2O3/c16-11-10(6-3-7-14-11)15-12(17)8-4-1-2-5-9(8)13(15)18/h1-2,4-5,10H,3,6-7H2,(H,14,16)/t10-/m1/s1 |
| InChIKey | ZLYHJKFZUWNUEQ-SNVBAGLBSA-N |
| XLogP | 0.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|