C21H27BrN2O4 — CID 168911866
4-(8-bromooctoxy)-2-(2-oxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 168911866) has the molecular formula C21H27BrN2O4 and a molecular weight of 451.36 g/mol. Its IUPAC name is 4-(8-bromooctoxy)-2-(2-oxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-(8-bromooctoxy)-2-(2-oxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 168911866 |
| Molecular Formula | C21H27BrN2O4 |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 4-(8-bromooctoxy)-2-(2-oxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1NCCCC1N1C(=O)c2cccc(OCCCCCCCCBr)c2C1=O |
| InChI | InChI=1S/C21H27BrN2O4/c22-12-5-3-1-2-4-6-14-28-17-11-7-9-15-18(17)21(27)24(20(15)26)16-10-8-13-23-19(16)25/h7,9,11,16H,1-6,8,10,12-14H2,(H,23,25) |
| InChIKey | LZFNFLLSLNMNPN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|