C14H16N2O3 — CID 153385124
molecular hydrogen;2-(2-oxoazepan-3-yl)isoindole-1,3-dione (PubChem CID 153385124) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is molecular hydrogen;2-(2-oxoazepan-3-yl)isoindole-1,3-dione.
| Compound Name | molecular hydrogen;2-(2-oxoazepan-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 153385124 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | molecular hydrogen;2-(2-oxoazepan-3-yl)isoindole-1,3-dione |
| SMILES | O=C1NCCCCC1N1C(=O)c2ccccc2C1=O.[H][H] |
| InChI | InChI=1S/C14H14N2O3.H2/c17-12-11(7-3-4-8-15-12)16-13(18)9-5-1-2-6-10(9)14(16)19;/h1-2,5-6,11H,3-4,7-8H2,(H,15,17);1H |
| InChIKey | BSFGTGUROAMVSV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|