C18H23NO2 — CID 123786237
2-cyclodecylisoindole-1,3-dione (PubChem CID 123786237) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-cyclodecylisoindole-1,3-dione.
| Compound Name | 2-cyclodecylisoindole-1,3-dione |
|---|---|
| PubChem CID | 123786237 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 2-cyclodecylisoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C1CCCCCCCCC1 |
| InChI | InChI=1S/C18H23NO2/c20-17-15-12-8-9-13-16(15)18(21)19(17)14-10-6-4-2-1-3-5-7-11-14/h8-9,12-14H,1-7,10-11H2 |
| InChIKey | YBYUJAYFGBNHGH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|