C20H24N2O3 — CID 1122069
2-[4-(piperidine-1-carbonyl)cyclohexyl]isoindole-1,3-dione (PubChem CID 1122069) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-[4-(piperidine-1-carbonyl)cyclohexyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(piperidine-1-carbonyl)cyclohexyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 1122069 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 2-[4-(piperidine-1-carbonyl)cyclohexyl]isoindole-1,3-dione |
| SMILES | O=C(C1CCC(N2C(=O)c3ccccc3C2=O)CC1)N1CCCCC1 |
| InChI | InChI=1S/C20H24N2O3/c23-18(21-12-4-1-5-13-21)14-8-10-15(11-9-14)22-19(24)16-6-2-3-7-17(16)20(22)25/h2-3,6-7,14-15H,1,4-5,8-13H2 |
| InChIKey | KFZRFBNURVYFEP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|