C15H15NO3 — CID 173386618
4-(1,3-dioxoisoindol-2-yl)cyclohexane-1-carbaldehyde (PubChem CID 173386618) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)cyclohexane-1-carbaldehyde.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 173386618 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)cyclohexane-1-carbaldehyde |
| SMILES | O=CC1CCC(N2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C15H15NO3/c17-9-10-5-7-11(8-6-10)16-14(18)12-3-1-2-4-13(12)15(16)19/h1-4,9-11H,5-8H2 |
| InChIKey | DHQFJFWWRICSCZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|