C14H13NO5 — CID 146503193
2-[5-(1,3-dioxoisoindol-2-yl)-1,3-dioxan-2-yl]acetaldehyde (PubChem CID 146503193) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is 2-[5-(1,3-dioxoisoindol-2-yl)-1,3-dioxan-2-yl]acetaldehyde.
| Compound Name | 2-[5-(1,3-dioxoisoindol-2-yl)-1,3-dioxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 146503193 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-[5-(1,3-dioxoisoindol-2-yl)-1,3-dioxan-2-yl]acetaldehyde |
| SMILES | O=CCC1OCC(N2C(=O)c3ccccc3C2=O)CO1 |
| InChI | InChI=1S/C14H13NO5/c16-6-5-12-19-7-9(8-20-12)15-13(17)10-3-1-2-4-11(10)14(15)18/h1-4,6,9,12H,5,7-8H2 |
| InChIKey | KTLXZYSXLMTIMT-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|