C18H22N2O7 — CID 166323787
2-[2-[[(3R,5S)-3,4,5-trihydroxypiperidin-1-yl]methyl]-1,3-dioxan-5-yl]isoindole-1,3-dione (PubChem CID 166323787) has the molecular formula C18H22N2O7 and a molecular weight of 378.38 g/mol. Its IUPAC name is 2-[2-[[(3R,5S)-3,4,5-trihydroxypiperidin-1-yl]methyl]-1,3-dioxan-5-yl]isoindole-1,3-dione.
| Compound Name | 2-[2-[[(3R,5S)-3,4,5-trihydroxypiperidin-1-yl]methyl]-1,3-dioxan-5-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 166323787 |
| Molecular Formula | C18H22N2O7 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 2-[2-[[(3R,5S)-3,4,5-trihydroxypiperidin-1-yl]methyl]-1,3-dioxan-5-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C1COC(CN2C[C@@H](O)C(O)[C@@H](O)C2)OC1 |
| InChI | InChI=1S/C18H22N2O7/c21-13-5-19(6-14(22)16(13)23)7-15-26-8-10(9-27-15)20-17(24)11-3-1-2-4-12(11)18(20)25/h1-4,10,13-16,21-23H,5-9H2/t10?,13-,14+,15?,16? |
| InChIKey | UHQBCORYVUFKAH-AORFDBMSSA-N |
| XLogP | -1.58 |
| TPSA | 119.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|