C15H18N2O4 — CID 103734065
2-[3-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]propyl]isoindole-1,3-dione (PubChem CID 103734065) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-[3-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 103734065 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-[3-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCN1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C15H18N2O4/c18-12-8-16(9-13(12)19)6-3-7-17-14(20)10-4-1-2-5-11(10)15(17)21/h1-2,4-5,12-13,18-19H,3,6-9H2/t12-,13+ |
| InChIKey | KJTWBHQREQLRLQ-BETUJISGSA-N |
| XLogP | -0.29 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|