C18H25N3O4S — CID 48736556
N-[1-[3-(1,3-dioxoisoindol-2-yl)propyl]piperidin-4-yl]-N-methylmethanesulfonamide (PubChem CID 48736556) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is N-[1-[3-(1,3-dioxoisoindol-2-yl)propyl]piperidin-4-yl]-N-methylmethanesulfonamide.
| Compound Name | N-[1-[3-(1,3-dioxoisoindol-2-yl)propyl]piperidin-4-yl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 48736556 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-[1-[3-(1,3-dioxoisoindol-2-yl)propyl]piperidin-4-yl]-N-methylmethanesulfonamide |
| SMILES | CN(C1CCN(CCCN2C(=O)c3ccccc3C2=O)CC1)S(C)(=O)=O |
| InChI | InChI=1S/C18H25N3O4S/c1-19(26(2,24)25)14-8-12-20(13-9-14)10-5-11-21-17(22)15-6-3-4-7-16(15)18(21)23/h3-4,6-7,14H,5,8-13H2,1-2H3 |
| InChIKey | OSSYUYLPLBXPMA-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|