C16H20N2O2 — CID 8557612
2-[2-(4-methylpiperidin-1-yl)ethyl]isoindole-1,3-dione (PubChem CID 8557612) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-[2-(4-methylpiperidin-1-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(4-methylpiperidin-1-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 8557612 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 2-[2-(4-methylpiperidin-1-yl)ethyl]isoindole-1,3-dione |
| SMILES | CC1CCN(CCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C16H20N2O2/c1-12-6-8-17(9-7-12)10-11-18-15(19)13-4-2-3-5-14(13)16(18)20/h2-5,12H,6-11H2,1H3 |
| InChIKey | PMFRKKJAWNNPKL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|