C15H21Cl2N3O2 — CID 127021054
2-[2-(4-aminopiperidin-1-yl)ethyl]isoindole-1,3-dione;dihydrochloride (PubChem CID 127021054) has the molecular formula C15H21Cl2N3O2 and a molecular weight of 346.26 g/mol. Its IUPAC name is 2-[2-(4-aminopiperidin-1-yl)ethyl]isoindole-1,3-dione;dihydrochloride.
| Compound Name | 2-[2-(4-aminopiperidin-1-yl)ethyl]isoindole-1,3-dione;dihydrochloride |
|---|---|
| PubChem CID | 127021054 |
| Molecular Formula | C15H21Cl2N3O2 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 2-[2-(4-aminopiperidin-1-yl)ethyl]isoindole-1,3-dione;dihydrochloride |
| SMILES | Cl.Cl.NC1CCN(CCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C15H19N3O2.2ClH/c16-11-5-7-17(8-6-11)9-10-18-14(19)12-3-1-2-4-13(12)15(18)20;;/h1-4,11H,5-10,16H2;2*1H |
| InChIKey | SHVPSWWSKNUVEM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|