C20H21Cl2N3O2 — CID 3088495
2-[2-[4-(4-chlorophenyl)piperazin-1-yl]ethyl]isoindole-1,3-dione;hydrochloride (PubChem CID 3088495) has the molecular formula C20H21Cl2N3O2 and a molecular weight of 406.31 g/mol. Its IUPAC name is 2-[2-[4-(4-chlorophenyl)piperazin-1-yl]ethyl]isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-[2-[4-(4-chlorophenyl)piperazin-1-yl]ethyl]isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 3088495 |
| Molecular Formula | C20H21Cl2N3O2 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 2-[2-[4-(4-chlorophenyl)piperazin-1-yl]ethyl]isoindole-1,3-dione;hydrochloride |
| SMILES | Cl.O=C1c2ccccc2C(=O)N1CCN1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H20ClN3O2.ClH/c21-15-5-7-16(8-6-15)23-12-9-22(10-13-23)11-14-24-19(25)17-3-1-2-4-18(17)20(24)26;/h1-8H,9-14H2;1H |
| InChIKey | XUAJPXNOMDWTNJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|