C16H16N4O2S3 — CID 164622653
2-[2-[4-(5-sulfanylidenedithiazol-4-yl)piperazin-1-yl]ethyl]isoindole-1,3-dione (PubChem CID 164622653) has the molecular formula C16H16N4O2S3 and a molecular weight of 392.53 g/mol. Its IUPAC name is 2-[2-[4-(5-sulfanylidenedithiazol-4-yl)piperazin-1-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-(5-sulfanylidenedithiazol-4-yl)piperazin-1-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 164622653 |
| Molecular Formula | C16H16N4O2S3 |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 2-[2-[4-(5-sulfanylidenedithiazol-4-yl)piperazin-1-yl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCN1CCN(c2nssc2=S)CC1 |
| InChI | InChI=1S/C16H16N4O2S3/c21-14-11-3-1-2-4-12(11)15(22)20(14)10-7-18-5-8-19(9-6-18)13-16(23)24-25-17-13/h1-4H,5-10H2 |
| InChIKey | KTMKDWHFFOKEQF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|