C24H29BrClN3O2 — CID 24839637
2-[6-[4-(2-chlorophenyl)piperazin-1-yl]hexyl]isoindole-1,3-dione;hydrobromide (PubChem CID 24839637) has the molecular formula C24H29BrClN3O2 and a molecular weight of 506.87 g/mol. Its IUPAC name is 2-[6-[4-(2-chlorophenyl)piperazin-1-yl]hexyl]isoindole-1,3-dione;hydrobromide.
| Compound Name | 2-[6-[4-(2-chlorophenyl)piperazin-1-yl]hexyl]isoindole-1,3-dione;hydrobromide |
|---|---|
| PubChem CID | 24839637 |
| Molecular Formula | C24H29BrClN3O2 |
| Molecular Weight | 506.87 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | 2-[6-[4-(2-chlorophenyl)piperazin-1-yl]hexyl]isoindole-1,3-dione;hydrobromide |
| SMILES | Br.O=C1c2ccccc2C(=O)N1CCCCCCN1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C24H28ClN3O2.BrH/c25-21-11-5-6-12-22(21)27-17-15-26(16-18-27)13-7-1-2-8-14-28-23(29)19-9-3-4-10-20(19)24(28)30;/h3-6,9-12H,1-2,7-8,13-18H2;1H |
| InChIKey | CLODUANLGYLWLV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.87 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|