C28H36ClN3O2 — CID 127053246
2-[9-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]nonyl]isoindole-1,3-dione (PubChem CID 127053246) has the molecular formula C28H36ClN3O2 and a molecular weight of 482.07 g/mol. Its IUPAC name is 2-[9-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]nonyl]isoindole-1,3-dione.
| Compound Name | 2-[9-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]nonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 127053246 |
| Molecular Formula | C28H36ClN3O2 |
| Molecular Weight | 482.07 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | 2-[9-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]nonyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCCCCCCN1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C28H36ClN3O2/c29-24-14-12-23(13-15-24)22-31-20-18-30(19-21-31)16-8-4-2-1-3-5-9-17-32-27(33)25-10-6-7-11-26(25)28(32)34/h6-7,10-15H,1-5,8-9,16-22H2 |
| InChIKey | WQQOKRCSOQWISG-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.07 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|